What is the molecular formula of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The molecular formula is C11H9ClO2S.
What is the molecular weight of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The molecular weight is 240.71 g/mol.
What is the IUPAC name of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The IUPAC name is methyl 2-(5-chloro-1-benzothiophen-3-yl)acetate.
What is the InChI of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The InChI is InChI=1S/C11H9ClO2S/c1-14-11(13)4-7-6-15-10-3-2-8(12)5-9(7)10/h2-3,5-6H,4H2,1H3.
What is the InChIKey of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The InChIKey is JWFDIBIIXZVEBI-UHFFFAOYSA-N.
What is the canonical SMILES of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The canonical SMILES is COC(=O)CC1=CSC2=C1C=C(C=C2)Cl.
What is the CAS number of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The CAS number is 95834-67-6.
What is the XLogP3-AA value of methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate?
The XLogP3-AA value is 3.4.
How many hydrogen bond acceptor counts does methyl 2-(5-chlorobenzo[b]thiophen-3-yl)acetate have?
It has 3 hydrogen bond acceptor counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.