What is the molecular formula of Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
The molecular formula is C14H18O2.
When was Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci) created in PubChem?
It was created on August 9, 2005.
What is the molecular weight of Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
The molecular weight is 218.29 g/mol.
What is the IUPAC Name of Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
The IUPAC Name is 2-[4-(3-methylbut-2-enyl)phenyl]propanoic acid.
What is the Canonical SMILES of Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
The Canonical SMILES is CC(C1=CC=C(C=C1)CC=C(C)C)C(=O)O.
What is the InChIKey of Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
The InChIKey is YZPIMMMQMYKRAK-UHFFFAOYSA-N.
How many Hydrogen Bond Donor Count does Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci) have?
It has 1 Hydrogen Bond Donor Count.
What is the XLogP3 value of Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
The XLogP3 value is 3.8.
How many Rotatable Bond Count does Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci) have?
It has 4 Rotatable Bond Count.
Is the Compound Is Canonicalized for Benzeneacetic acid, -alpha--methyl-4-(3-methyl-2-butenyl)-,(-)-(9ci)?
Yes, the Compound Is Canonicalized.