What is the molecular formula of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The molecular formula is C11H11N3S.
When was 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine created in PubChem?
It was created on July 14, 2005.
What is the IUPAC name of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The IUPAC name is 2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine.
What is the molecular weight of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The molecular weight is 217.29 g/mol.
What is the InChIKey of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The InChIKey is PVKVTEYRFBNYMQ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The Canonical SMILES is C1C2=C(N(N=C2CS1)C3=CC=CC=C3)N.
How many Hydrogen Bond Donor Count does 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine have?
It has 1 Hydrogen Bond Donor Count.
What is the Heavy Atom Count of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The Heavy Atom Count is 15.
Is 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine a canonicalized compound?
Yes, it is a canonicalized compound.
What is the topological polar surface area of 2-Phenyl-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-ylamine?
The topological polar surface area is 69.1 Ų.