954223-14-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-(3-nitrophenoxy)azetidine.
The molecular formula of the compound is C9H10N2O3.
The molecular weight of the compound is 194.19 g/mol.
The InChI of the compound is InChI=1S/C9H10N2O3/c12-11(13)7-2-1-3-8(4-7)14-9-5-10-6-9/h1-4,9-10H,5-6H2.
The InChIKey of the compound is OBOGYFVCVNUEKT-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1C(CN1)OC2=CC=CC(=C2)[N+](=O)[O-].
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 67.1 Å2.
Yes, the compound is canonicalized.