CAS
954223-28-0 Purity
---
954223-28-0 Purity
---
Inquiry Basket
2-Oxo-1-(pyridin-3-ylmethyl)-1,2-dihydropyridine-3-carboxylic acid
CAS
954225-20-8
Catalog Number
ACM954225208
Category
Other Products
Molecular Weight
230.22
Molecular Formula
C12H10N2O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C12H10N2O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 230.22 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carboxylic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H10N2O3/c15-11-10(12(16)17)4-2-6-14(11)8-9-3-1-5-13-7-9/h1-7H,8H2,(H,16,17).
What is the InChIKey of the compound?
The InChIKey of the compound is RVZRRKIEIRGXJP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CN=C1)CN2C=CC=C(C2=O)C(=O)O.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the exact mass of the compound?
The exact mass of the compound is 230.06914219 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.
Recommended Products
CAS
95422-34-7 Purity
---
95422-34-7 Purity
---
CAS
954225-72-0 Purity
96%
954225-72-0 Purity
96%
