What is the molecular formula of 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
The molecular formula is C12H20ClNO2S.
When was 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride created?
It was created on 2007-06-18.
What is the molecular weight of 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
The molecular weight is 283.85 g/mol.
How many hydrogen bond donor counts are in 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
There are 2 hydrogen bond donor counts.
What is the topological polar surface area of 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
The topological polar surface area is 69.8 Ų.
How many rotatable bond counts are in 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
There are 6 rotatable bond counts.
Is the compound is canonicalized in 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
Yes, the compound is canonicalized.
What is the molecular formula of the parent compound of 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
The parent compound has CID 16096489 with the molecular formula 2-[4-Ethylsulfanyl-2,5-bis(trideuteriomethoxy)phenyl]ethanamine.
How many isotope atom counts are there in 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
There are 6 isotope atom counts.
What is the Canonical SMILES notation of 2,5-(Dimethoxy-d6)-4-(ethylthio)phenethylamine hydrochloride?
The Canonical SMILES notation is CCSC1=C(C=C(C(=C1)OC)CCN)OC.Cl.