951380-42-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 46781360.
The molecular formula of the compound is C10H15Cl2NO2.
The molecular weight of the compound is 258.17 g/mol.
The IUPAC name of the compound is 2-[4-chloro-2,5-bis(trideuteriomethoxy)phenyl]ethanamine hydrochloride.
The InChI of the compound is InChI=1S/C10H14ClNO2.ClH/c1-13-9-6-8(11)10(14-2)5-7(9)3-4-12;/h5-6H,3-4,12H2,1-2H3;1H/i1D3,2D3.
The canonical SMILES of the compound is COC1=CC(=C(C=C1CCN)OC)Cl.Cl.
The compound has a hydrogen bond donor count of 2.
The compound has a hydrogen bond acceptor count of 3.
The compound has a rotatable bond count of 4.
Yes, the compound is canonicalized.