What is the molecular formula of 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl)?
The molecular formula is C5H5F3N4O.
When was 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl) created and modified in PubChem?
It was created on July 11, 2005, and last modified on December 30, 2023.
What is the IUPAC name of 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl)?
The IUPAC name is 2,3-diamino-6-(trifluoromethyl)pyrimidin-4-one.
What is the InChI of 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl)?
The InChI is InChI=1S/C5H5F3N4O/c6-5(7,8)2-1-3(13)12(10)4(9)11-2/h1H,10H2,(H2,9,11).
What is the molecular weight of 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl)?
The molecular weight is 194.11 g/mol.
How many hydrogen bond donor counts does 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl) have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl)?
The topological polar surface area is 84.7 Å2.
Does 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl) have any defined atom stereocenter count?
No, it has a defined atom stereocenter count of 0.
What is the canonical SMILES for 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl)?
The canonical SMILES is C1=C(N=C(N(C1=O)N)N)C(F)(F)F.
Is 4(3H)-Pyrimidinone,2,3-diamino-6-(trifluoromethyl) considered a canonicalized compound in PubChem?
Yes, it is considered a canonicalized compound in PubChem.