What is the molecular formula of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The molecular formula is C22H18N2O.
What is the molecular weight of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The molecular weight is 326.4 g/mol.
What is the IUPAC name of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The IUPAC name is 3-anilino-1-methyl-4-phenylquinolin-2-one.
What is the InChI of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The InChI is InChI=1S/C22H18N2O/c1-24-19-15-9-8-14-18(19)20(16-10-4-2-5-11-16)21(22(24)25)23-17-12-6-3-7-13-17/h2-15,23H,1H3.
What is the InChIKey of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The InChIKey is ZJZZFOBUOOIRGH-UHFFFAOYSA-N.
What is the Canonical SMILES of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The Canonical SMILES is CN1C2=CC=CC=C2C(=C(C1=O)NC3=CC=CC=C3)C4=CC=CC=C4.
What is the XLogP3-AA value of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The XLogP3-AA value is 4.4.
How many hydrogen bond donor counts does 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino) have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino) have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 2(1H)-Quinolinone,1-methyl-4-phenyl-3-(phenylamino)?
The topological polar surface area is 32.3 Ų.