950-81-2 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C11H10BrN3O.
The molecular weight of the compound is 280.12 g/mol.
The IUPAC name of the compound is 5-bromo-N-(4-methoxyphenyl)pyrazin-2-amine.
The CAS number of the compound is 950845-92-8.
The InChI code of the compound is InChI=1S/C11H10BrN3O/c1-16-9-4-2-8(3-5-9)15-11-7-13-10(12)6-14-11/h2-7H,1H3,(H,14,15).
The InChIKey of the compound is RRCDAYXAURXRIT-UHFFFAOYSA-N.
The XLogP3-AA value of the compound is 2.7.
There is one hydrogen bond donor atom present in the compound.
There are four hydrogen bond acceptor atoms present in the compound.
There are three rotatable bonds present in the compound.