N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline

• CAS: 950845-96-2
• Catalog Number: ACM950845962
• Category: Other Products
• Molecular Formula: C₁₁H₁₁BrN₄O

Custom Q&A

What is the molecular formula of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The molecular formula is C11H11BrN4O.

What is the molecular weight of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The molecular weight is 295.14 g/mol.

When was N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline created?

It was created on October 30, 2011.

What is the IUPAC name of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The IUPAC name is 1-N-(5-bromopyrazin-2-yl)-4-methoxybenzene-1,2-diamine.

What is the InChI of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The InChI is InChI=1S/C11H11BrN4O/c1-17-7-2-3-9(8(13)4-7)16-11-6-14-10(12)5-15-11/h2-6H,13H2,1H3,(H,15,16).

What is the InChIKey of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The InChIKey is LOQDWAMBYVIPGR-UHFFFAOYSA-N.

What is the canonical SMILES of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The canonical SMILES is COC1=CC(=C(C=C1)NC2=CN=C(C=N2)Br)N.

What is the CAS number of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The CAS number is 950845-96-2.

What is the XLogP3-AA value of N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline?

The XLogP3-AA value is 2.

Is N-(5-Bromopyrazin-2-yl)-2-amino-4-methoxyaniline a canonicalized compound?

Yes, it is a canonicalized compound.