950697-95-7 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C9H16O2Si.
The synonyms for the compound are AKOS006323919 and 950698-00-7.
The molecular weight of the compound is 184.31 g/mol.
The IUPAC name of the compound is 2-[dimethyl-(5-methylfuran-2-yl)silyl]ethanol.
The InChI of the compound is InChI=1S/C9H16O2Si/c1-8-4-5-9(11-8)12(2,3)7-6-10/h4-5,10H,6-7H2,1-3H3.
The InChIKey of the compound is BJXBHQURIGFJBS-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC=C(O1)[Si](C)(C)CCO.
There is 1 hydrogen bond donor atom in the compound.
There are 2 hydrogen bond acceptor atoms in the compound.
There are 3 rotatable bonds in the compound.