CAS
95068-26-1 Purity
---
95068-26-1 Purity
---
Inquiry Basket
(Bromomethyl)dimethyl(5-methylfuran-2-yl)silane
CAS
950697-95-7
Catalog Number
ACM950697957
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is bromomethyl-dimethyl-(5-methylfuran-2-yl)silane.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H13BrOSi.
What is the molecular weight of the compound?
The molecular weight of the compound is 233.18 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H13BrOSi/c1-7-4-5-8(10-7)11(2,3)6-9/h4-5H,6H2,1-3H3.
What is the InChIKey of the compound?
The InChIKey of the compound is QPZHHSBTMKSCMC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC=C(O1)[Si](C)(C)CBr.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 0.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 1.
How many rotatable bonds does the compound have?
The compound has 2 rotatable bonds.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 13.1?2.
Recommended Products
![Spiro[4.6]undecane-2-carbonyl chloride(9ci)](https://resource.alfa-chemistry.com/structure/95070-39-6.gif)
CAS
95073-80-6 Purity
96%
95073-80-6 Purity
96%
