CAS
950667-02-4 Purity
---
950667-02-4 Purity
---
Inquiry Basket
3-Bromo-5-iodobenzoic acid
CAS
95068-0-12
Catalog Number
ACM95068012
Category
Other Products
Molecular Formula
C7H4BrIO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5-iodobenzoic acid?
The molecular formula of 3-Bromo-5-iodobenzoic acid is C7H4BrIO2.
What is the molecular weight of 3-Bromo-5-iodobenzoic acid?
The molecular weight of 3-Bromo-5-iodobenzoic acid is 326.91 g/mol.
What is the IUPAC name of 3-Bromo-5-iodobenzoic acid?
The IUPAC name of 3-Bromo-5-iodobenzoic acid is 3-bromo-5-iodobenzoic acid.
What is the InChI of 3-Bromo-5-iodobenzoic acid?
The InChI of 3-Bromo-5-iodobenzoic acid is InChI=1S/C7H4BrIO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11).
What is the InChIKey of 3-Bromo-5-iodobenzoic acid?
The InChIKey of 3-Bromo-5-iodobenzoic acid is MKJBJYCBKXPQSY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-iodobenzoic acid?
The canonical SMILES of 3-Bromo-5-iodobenzoic acid is C1=C(C=C(C=C1Br)I)C(=O)O.
What is the CAS number of 3-Bromo-5-iodobenzoic acid?
The CAS number of 3-Bromo-5-iodobenzoic acid is 188815-32-9.
What is the XLogP3-AA value of 3-Bromo-5-iodobenzoic acid?
The XLogP3-AA value of 3-Bromo-5-iodobenzoic acid is 2.8.
How many hydrogen bond donor counts does 3-Bromo-5-iodobenzoic acid have?
3-Bromo-5-iodobenzoic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Bromo-5-iodobenzoic acid have?
3-Bromo-5-iodobenzoic acid has 2 hydrogen bond acceptor counts.
Recommended Products
![ACETAMIDE,N-[1-(3,4-DIMETHYLPHENYL)VINYL]-](https://resource.alfa-chemistry.com/structure/950667-02-4.gif)
