CAS
947534-11-4 Purity
---
947534-11-4 Purity
---
Inquiry Basket
1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride
CAS
947534-15-8
Catalog Number
ACM947534158
Category
Other Products
Molecular Weight
239.82892
Molecular Formula
C9H18ClNS2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride
What is the molecular formula of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The molecular formula of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is C9H18ClNS2.
What is the molecular weight of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The molecular weight of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is 239.8 g/mol.
What is the IUPAC name of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The IUPAC name of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is 1,5-dithia-10-azaspiro[5.6]dodecane;hydrochloride.
What is the InChI of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The InChI of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is InChI=1S/C9H17NS2.ClH/c1-3-9(4-6-10-5-1)11-7-2-8-12-9;/h10H,1-8H2;1H.
What is the InChIKey of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The InChIKey of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is UCSFBYJQMXLFHX-UHFFFAOYSA-N.
What is the canonical SMILES of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The canonical SMILES of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is C1CC2(CCNC1)SCCCS2.Cl.
What is the CAS number of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The CAS number of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is 947534-15-8.
What is the hydrogen bond donor count of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The hydrogen bond donor count of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is 2.
What is the hydrogen bond acceptor count of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The hydrogen bond acceptor count of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is 3.
What is the topological polar surface area of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride?
The topological polar surface area of 1,5-Dithia-9-aza-spiro[5.6]dodecane hydrochloride is 62.6 Å^2.
Recommended Products
![1,4-Dioxa-8-aza-spiro[4.6]undecane,hydrochloride](https://resource.alfa-chemistry.com/structure/947534-11-4.gif)
![1-Oxa-4-thia-8-aza-spiro[4.6]undecane,hydrochloride](https://resource.alfa-chemistry.com/structure/947534-13-6.gif)
![1,5-Dioxa-9-aza-spiro[5.6]dodecane, hydrochloride](https://resource.alfa-chemistry.com/structure/947534-14-7.gif)
