What is the molecular formula of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The molecular formula is C10H12BrN3.
What is the molecular weight of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The molecular weight is 254.13 g/mol.
What is the IUPAC name of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The IUPAC name is 6-bromo-2-tert-butylimidazo[1,2-a]pyrimidine.
What is the InChI of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The InChI is InChI=1S/C10H12BrN3/c1-10(2,3)8-6-14-5-7(11)4-12-9(14)13-8/h4-6H,1-3H3.
What is the InChIKey of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The InChIKey is WMSUUGWLJJZSGJ-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The canonical SMILES is CC(C)(C)C1=CN2C=C(C=NC2=N1)Br.
What is the CAS number of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The CAS number is 947533-72-4.
What is the DSSTox Substance ID of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The DSSTox Substance ID is DTXSID00669611.
What is the XLogP3-AA value of 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine?
The XLogP3-AA value is 3.5.
Is 6-Bromo-2-tert-butyl-imidazo[1,2-a]pyrimidine a canonicalized compound?
Yes, it is a canonicalized compound.