Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester

Name: Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester
SKU: ACM947533666
Rating: 5 (1 reviews)

CAS

947533-66-6

Catalog Number

ACM947533666

Category

Other Products

Molecular Weight

342.0779364

Molecular Formula

C₁₀H₉F₂IO₃

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester

What is the molecular formula of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The molecular formula of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is C10H9F2IO3.

What are the synonyms of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The synonyms of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester are 947533-66-6, DIFLUORO-(3-IODO-PHENOXY)-ACETIC ACID ETHYL ESTER, DTXSID40700890, and AKOS015150697.

What is the molecular weight of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The molecular weight of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is 342.08 g/mol.

What is the IUPAC name of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The IUPAC name of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is ethyl 2,2-difluoro-2-(3-iodophenoxy)acetate.

What is the InChI identifier of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The InChI identifier of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is InChI=1S/C10H9F2IO3/c1-2-15-9(14)10(11,12)16-8-5-3-4-7(13)6-8/h3-6H,2H2,1H3.

What is the InChIKey of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The InChIKey of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is ZAFJIBCFMZIJGL-UHFFFAOYSA-N.

What is the canonical SMILES of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The canonical SMILES of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is CCOC(=O)C(OC1=CC(=CC=C1)I)(F)F.

What is the CAS number of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The CAS number of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is 947533-66-6.

What is the XLogP3-AA value of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?

The XLogP3-AA value of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is 3.6.

Is Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester a canonicalized compound?

Yes, Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is a canonicalized compound.

Recommended Products