CAS
945839-46-3 Purity
96%
945839-46-3 Purity
96%
Inquiry Basket
N-(tert-Butyl)-6-chloropyrimidin-4-amine
CAS
94589-38-8
Catalog Number
ACM94589388
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is N-tert-butyl-6-chloropyrimidin-4-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H12ClN3/c1-8(2,3)12-7-4-6(9)10-5-11-7/h4-5H,1-3H3,(H,10,11,12).
What is the InChIKey of the compound?
The InChIKey of the compound is YWCAYWDYSOKSJG-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC(C)(C)NC1=CC(=NC=N1)Cl.
What is the molecular weight of the compound?
The molecular weight of the compound is 185.65 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 37.8 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the covalently-bonded unit count of the compound?
The covalently-bonded unit count of the compound is 1.
Recommended Products
![2,8-Diazaspiro[4.5]decan-3-one hydrochloride](https://resource.alfa-chemistry.com/structure/945892-88-6.gif)
