94572-68-6 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound containing Glycine is C21H17N3O5.
The molecular weight of the compound is 391.4 g/mol.
The IUPAC name of the compound is 2-[[1-cyano-7-(2,6-dimethylphenoxy)-4-hydroxyisoquinoline-3-carbonyl]amino]acetic acid.
The InChIKey of the compound is HLLVEWCXEKIHLI-UHFFFAOYSA-N.
The canonical SMILES notation of the compound is CC1=C(C(=CC=C1)C)OC2=CC3=C(C=C2)C(=C(N=C3C#N)C(=O)NCC(=O)O).
The compound has 3 hydrogen bond donor counts.
The XLogP3-AA value of the compound is 3.8.
The topological polar surface area of the compound is 133 Å^2.
The compound has 5 rotatable bonds.
Yes, the compound is canonicalized according to PubChem.