What is the molecular formula of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
The molecular formula is C8H15N3O4S.
What is the molecular weight of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
The molecular weight is 249.29 g/mol.
What are the synonyms of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
Some synonyms include 2,6-Dimethylbenzene-1,3,5-triamine sulphate and 94135-21-4.
What is the IUPAC name of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
The IUPAC name is 2,4-dimethylbenzene-1,3,5-triamine;sulfuric acid.
What is the InChI key of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
The InChI key is MOVJQGOQYSIWMW-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
The Canonical SMILES is CC1=C(C(=C(C=C1N)N)C)N.OS(=O)(=O)O.
What is the CAS number of 2,6-Dimethylbenzene-1,3,5-triamine sulfate?
The CAS number is 94135-21-4.
How many hydrogen bond donor counts does 2,6-Dimethylbenzene-1,3,5-triamine sulfate have?
It has 5 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,6-Dimethylbenzene-1,3,5-triamine sulfate have?
It has 7 hydrogen bond acceptor counts.
Is 2,6-Dimethylbenzene-1,3,5-triamine sulfate considered as a canonicalized compound?
Yes, it is considered a canonicalized compound according to PubChem.