What is the molecular formula of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The molecular formula is C8H14ClN3.
What is the molecular weight of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The molecular weight is 187.67 g/mol.
What is the IUPAC name of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The IUPAC name is 2,4-dimethylbenzene-1,3,5-triamine; hydrochloride.
What is the InChI of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The InChI is InChI=1S/C8H13N3.ClH/c1-4-6(9)3-7(10)5(2)8(4)11;/h3H,9-11H2,1-2H3;1H.
What is the InChIKey of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The InChIKey is HUPRNZLUDKGPHB-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The canonical SMILES is CC1=C(C(=C(C=C1N)N)C)N.Cl.
What is the CAS number of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The CAS number is 94135-20-3.
What is the European Community (EC) number of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The European Community (EC) number is 302-889-3.
What is the UNII of 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride?
The UNII is N2V4TDF9L3.
Is 2,6-Dimethylbenzene-1,3,5-triamine hydrochloride a canonicalized compound?
Yes, it is a compound that has been canonicalized.