What is the molecular formula of 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The molecular formula is C16H6Cl3F3O.
What is the molecular weight of 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The molecular weight is 377.6 g/mol.
What is the IUPAC name of 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The IUPAC name is 1,3-dichloro-6-(trifluoromethyl)phenanthrene-9-carbonyl chloride.
What is the InChIKey of 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The InChIKey is NJKFWXUBFGNOOC-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The Canonical SMILES is C1=CC2=C(C=C3C(=CC(=CC3=C2C=C1C(F)(F)F)Cl)Cl)C(=O)Cl.
What is the CAS number for 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The CAS number is 94133-67-2.
How many hydrogen bond acceptors does 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride have?
It has 4 hydrogen bond acceptors.
What is the topological polar surface area of 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride?
The topological polar surface area is 17.1 Å^2.
How many rotatable bonds does 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride have?
It has 1 rotatable bond.
Is 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-carbonyl chloride a canonicalized compound?
Yes, it is a canonicalized compound.