What is the molecular formula of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The molecular formula is C8H13BrO4.
What is the IUPAC name of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The IUPAC name is ethyl 2-[2-(bromomethyl)-1,3-dioxolan-2-yl]acetate.
What is the InChI of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The InChI is InChI=1S/C8H13BrO4/c1-2-11-7(10)5-8(6-9)12-3-4-13-8/h2-6H2,1H3.
What is the InChIKey of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The InChIKey is WDFFBKCRZJATND-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The canonical SMILES is CCOC(=O)CC1(OCCO1)CBr.
What is the molecular weight of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The molecular weight is 253.09 g/mol.
What is the CAS number of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The CAS number is 94133-61-6.
What is the European Community (EC) number of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The European Community (EC) number is 302-722-4.
What is the DSSTox Substance ID of Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate?
The DSSTox Substance ID is DTXSID10240672.
Is Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate a canonicalized compound?
Yes, Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate is canonicalized.