940958-93-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H12N2O3.
The IUPAC name of the compound is ethyl 3-methyl-4-oxidoquinoxalin-4-ium-2-carboxylate.
The InChI of the compound is InChI=1S/C12H12N2O3/c1-3-17-12(15)11-8(2)14(16)10-7-5-4-6-9(10)13-11/h4-7H,3H2,1-2H3.
The InChIKey of the compound is VNYXIHXFWAWXAB-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)C1=NC2=CC=CC=C2[N+](=C1C)[O-].
The molecular weight of the compound is 232.23 g/mol.
The XLogP3-AA value of the compound is 1.2.
The compound has 0 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor count.
The compound has 3 rotatable bond count.