What is the molecular formula of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The molecular formula is C8H5Cl2N3O2.
What is the molecular weight of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The molecular weight is 246.05 g/mol.
When was methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate created and last modified in PubChem?
It was created on 2009-05-29 and last modified on 2023-12-30.
What is the IUPAC name of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The IUPAC name is methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate.
What is the InChI of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The InChI is InChI=1S/C8H5Cl2N3O2/c1-15-8(14)4-3-11-13-6(10)2-5(9)12-7(4)13/h2-3H,1H3.
What is the Canonical SMILES of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The Canonical SMILES is COC(=O)C1=C2N=C(C=C(N2N=C1)Cl)Cl.
How many hydrogen bond donor counts are there in methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
There are 0 hydrogen bond donor counts.
What is the topological polar surface area of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The topological polar surface area is 56.5 Å2.
Is methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate a canonicalized compound according to PubChem?
Yes, the compound is canonicalized.
What is the complexity value of methyl 5,7-dichloropyrazolo[1,5-a]pyrimidine-3-carboxylate?
The complexity value is 266.