940284-55-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is [2,2-bis(bromomethyl)-3-phosphonooxypropyl] dihydrogen phosphate.
The InChI of the compound is InChI=1S/C5H12Br2O8P2/c6-1-5(2-7,3-14-16(8,9)10)4-15-17(11,12)13/h1-4H2,(H2,8,9,10)(H2,11,12,13).
The InChIKey of the compound is CSEOIVTVQILBPP-UHFFFAOYSA-N.
The canonical SMILES of the compound is C(C(COP(=O)(O)O)(CBr)CBr)OP(=O)(O)O.
The molecular formula of the compound is C5H12Br2O8P2.
The molecular weight of the compound is 421.90 g/mol.
The CAS number of the compound is 94030-76-9.
The EC number of the compound is 301-682-5.
The DSSTox Substance ID of the compound is DTXSID90240332.
Yes, the compound is canonicalized.