CAS
93983-72-3 Purity
---
93983-72-3 Purity
---
Inquiry Basket
2-(p-Phenoxyphenoxy)acetamide
CAS
93985-69-4
Catalog Number
ACM93985694
Category
Other Products
Molecular Formula
C14H13NO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
Acetamide, 2-(p-phenoxyphenoxy)-;Acetamide, 2-(p-phenoxyphenoxy)- (7CI)
What is the molecular formula of the compound?
The molecular formula of the compound is C14H13NO3.
What is the molecular weight of the compound?
The molecular weight of the compound is 243.26 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(4-phenoxyphenoxy)acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C14H13NO3/c15-14(16)10-17-11-6-8-13(9-7-11)18-12-4-2-1-3-5-12/h1-9H,10H2,(H2,15,16).
What is the InChIKey of the compound?
The InChIKey of the compound is JYQDIPJQHCZZFF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC=C(C=C1)OC2=CC=C(C=C2)OCC(=O)N.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 2.3.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 5 rotatable bond counts.
Recommended Products
![3-AMINO-N-[5-OXO-1-(2,4,6-TRICHLORO-PHENYL)-2,5-DIHYDRO-1H-PYRAZOL-3-YL]-BENZAMIDE](https://resource.alfa-chemistry.com/structure/939889-30-2.gif)
CAS
939889-30-2 Purity
---
939889-30-2 Purity
---
