93983-74-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H16N2O3.
The molecular weight of the compound is 272.30 g/mol.
The IUPAC name of the compound is 2-amino-N-(2,4-dimethoxyphenyl)benzamide.
The Canonical SMILES of the compound is COC1=CC(=C(C=C1)NC(=O)C2=CC=CC=C2N)OC.
There are 2 hydrogen bond donor counts in the compound.
There are 4 hydrogen bond acceptor counts in the compound.
The exact mass of the compound is 272.11609238 g/mol.
The topological polar surface area of the compound is 73.6 Ų.
There are 20 heavy atoms in the compound.
Yes, the compound is canonicalized.