93983-74-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H16N2O3.
The molecular weight of the compound is 272.30 g/mol.
The IUPAC name of the compound is 2-amino-N-(2,4-dimethoxyphenyl)benzamide.
The Canonical SMILES of the compound is COC1=CC(=C(C=C1)NC(=O)C2=CC=CC=C2N)OC.
There are 2 hydrogen bond donor counts in the compound.
There are 4 hydrogen bond acceptor counts in the compound.
The exact mass of the compound is 272.11609238 g/mol.
The topological polar surface area of the compound is 73.6 Ų.
There are 20 heavy atoms in the compound.
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Download