939757-99-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C12H15NO2.
The compound was first created on September 10, 2005.
The molecular weight is 205.25 g/mol.
The IUPAC name is methyl 4-phenylpyrrolidine-3-carboxylate.
The InChI code is InChI=1S/C12H15NO2/c1-15-12(14)11-8-13-7-10(11)9-5-3-2-4-6-9/h2-6,10-11,13H,7-8H2,1H3.
There are 3 hydrogen bond acceptors.
The exact mass is 205.110278721 g/mol.
There are 3 rotatable bonds.
Yes, the compound is canonicalized.
The topological polar surface area is 38.3 Å2.