What is the molecular formula of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
The molecular formula is C12H14ClNO2.
What is the molecular weight of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
The molecular weight is 239.70 g/mol.
What is the IUPAC name of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
The IUPAC name is methyl (3R,4S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylate.
What is the InChI of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
The InChI is InChI=1S/C12H14ClNO2/c1-16-12(15)10-7-14-6-9(10)8-4-2-3-5-11(8)13/h2-5,9-10,14H,6-7H2,1H3/t9-,10+/m1/s1.
What is the InChIKey of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
The InChIKey is SLESECKAUTVEET-ZJUUUORDSA-N.
How many hydrogen bond donor counts does Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate have?
It has 1 hydrogen bond donor count.
What is the hydrogen bond acceptor count of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate?
The topological polar surface area is 38.3 A^2.
How many defined atom stereocenter counts does Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate have?
It has 2 defined atom stereocenter counts.
Is Trans-methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.