Ammonium isoascorbate

CAS

93858-76-5

Catalog Number

ACM93858765

Category

Other Products

Molecular Weight

193.154640 [g/mol]

Molecular Formula

C6H11NO6

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Ammonium isoascorbate, EINECS 299-309-3, D-erythro-Hex-2-enonic acid, gamma-lactone, monoammonium salt, 93858-76-5

IUPAC Name

azanium;(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethanolate

InChI Key

GQYHDFIXEPEHIC-RKJRWTFHSA-O

Exact Mass

193.05900

H-Bond Acceptor

H-Bond Donor

What is the molecular formula of ammonium isoascorbate?

The molecular formula of ammonium isoascorbate is C6H11NO6.

What are the synonyms of ammonium isoascorbate?

The synonyms of ammonium isoascorbate are Ammonium isoascorbate, EINECS 299-309-3, 93858-76-5, and D-erythro-Hex-2-enonic acid, gamma-lactone, monoammonium salt.

What is the molecular weight of ammonium isoascorbate?

The molecular weight of ammonium isoascorbate is 193.15 g/mol.

What is the parent compound of ammonium isoascorbate?

The parent compound of ammonium isoascorbate is CID 54675810 (Erythorbic acid).

Which component compounds are present in ammonium isoascorbate?

The component compounds present in ammonium isoascorbate are CID 222 (Ammonia) and CID 54675810 (Erythorbic acid).

What is the IUPAC Name of ammonium isoascorbate?

The IUPAC Name of ammonium isoascorbate is azanium;(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethanolate.

What is the InChI of ammonium isoascorbate?

The InChI of ammonium isoascorbate is InChI=1S/C6H7O6.H3N/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,8-10H,1H2;1H3/q-1;/p+1/t2-,5-;/m1./s1.

What is the InChIKey of ammonium isoascorbate?

The InChIKey of ammonium isoascorbate is GQYHDFIXEPEHIC-RKJRWTFHSA-O.

What are the computed properties of ammonium isoascorbate?

The computed properties of ammonium isoascorbate include molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and compound is canonicalized.

Is the compound is canonicalized?

Yes, the compound is canonicalized.

Recommended Products