93840-58-5 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C23H21N3O8S.
The molecular weight of the compound is 499.5 g/mol.
The IUPAC name of the compound is 5-ethyl-3,8-dinitro-6-phenylphenanthridin-5-ium;ethyl sulfate.
The InChI code of the compound is InChI=1S/C21H16N3O4.C2H6O4S/c1-2-22-20-13-16(24(27)28)9-11-18(20)17-10-8-15(23(25)26)12-19(17)21(22)14-6-4-3-5-7-14;1-2-6-7(3,4)5/h3-13H,2H2,1H3;2H2,1H3,(H,3,4,5)/q+1;/p-1
The InChIKey of the compound is KVSATGGMSSOVOB-UHFFFAOYSA-M.
The Canonical SMILES of the compound is CC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)[N+](=O)[O-])[N+](=O)[O-].CCOS(=O)(=O)[O-].
The CAS number of the compound is 93840-65-4.
The compound has 0 hydrogen bond donor count.
The topological polar surface area of the compound is 170 Ų.
Yes, the compound is canonicalized.