What is the molecular formula of [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The molecular formula is C17H28Cl3NO.
What is the molecular weight of [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The molecular weight is 368.8 g/mol.
What are the synonyms for [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
Synonyms include 93840-58-5 and EINECS 298-923-9.
What is the IUPAC name of [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The IUPAC name is (2,4-dichlorophenoxy)methyl-dimethyl-octylazanium;chloride.
What is the InChIKey of [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The InChIKey is LKVRKEFXIWVRRJ-UHFFFAOYSA-M.
What is the Canonical SMILES representation of [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The Canonical SMILES representation is CCCCCCCC[N+](C)(C)COC1=C(C=C(C=C1)Cl)Cl.[Cl-].
What is the CAS number for [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The CAS number is 93840-58-5.
How many hydrogen bond acceptors does [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride have?
It has 2 hydrogen bond acceptors.
What is the topological polar surface area of [(2,4-Dichlorophenoxy)methyl]dimethyloctylammonium chloride?
The topological polar surface area is 9.2 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.