What is the molecular formula of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The molecular formula is C4H3N3O4.
What is the molecular weight of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The molecular weight is 157.08 g/mol.
What is 5-azaorotic acid?
5-azaorotic acid is a member of 1,3,5-triazines and a monocarboxylic acid.
What is the IUPAC name of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The IUPAC name is 4,6-dioxo-1H-1,3,5-triazine-2-carboxylic acid.
What is the InChI of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The InChI is InChI=1S/C4H3N3O4/c8-2(9)1-5-3(10)7-4(11)6-1/h(H,8,9)(H2,5,6,7,10,11).
What is the InChIKey of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The InChIKey is RYYCJUAHISIHTL-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The canonical SMILES is C1(=NC(=O)NC(=O)N1)C(=O)O.
What is the CAS number of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The CAS number is 937-13-3.
What is the XLogP3-AA value of 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo?
The XLogP3-AA value is -1.
How many hydrogen bond donor and acceptor count does 1,3,5-Triazine-2-carboxylic acid, 1,4,5,6-tetrahydro-4,6-dioxo have?
It has 3 hydrogen bond donors and 4 hydrogen bond acceptors.