93709-61-6 Purity
98 atom % D
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H17NO6.
The synonyms of the compound include:
93709-67-2
(2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid
L-Alanine,N-(3,4,5-trimethoxybenzoyl)-
(2S)-2-[(3,4,5-trimethoxyphenyl)formamido]propanoic acid
N-(3,4,5-trimethoxybenzoyl)alanine
The molecular weight of the compound is 283.28 g/mol.
The IUPAC name of the compound is (2S)-2-[(3,4,5-trimethoxybenzoyl)amino]propanoic acid.
The InChI of the compound is InChI=1S/C13H17NO6/c1-7(13(16)17)14-12(15)8-5-9(18-2)11(20-4)10(6-8)19-3/h5-7H,1-4H3,(H,14,15)(H,16,17)/t7-/m0/s1.
The InChIKey of the compound is LYDVPBQLBMIUQN-ZETCQYMHSA-N.
The canonical SMILES of the compound is CC(C(=O)O)NC(=O)C1=CC(=C(C(=C1)OC)OC)OC.
The isomeric SMILES of the compound is C[C@@H](C(=O)O)NC(=O)C1=CC(=C(C(=C1)OC)OC)OC.
The XLogP3-AA value of the compound is 1.1.
The compound has 2 hydrogen bond donor counts and 6 hydrogen bond acceptor counts.