CAS
936923-58-9 Purity
---
936923-58-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C11H13N3.
The molecular weight is 187.24 g/mol.
The IUPAC name is (1-benzylpyrazol-4-yl)methanamine.
The Canonical SMILES is C1=CC=C(C=C1)CN2C=C(C=N2)CN.
There is one hydrogen bond donor count.
The exact mass is 187.110947427 g/mol.
There are 3 rotatable bond counts.
The topological polar surface area is 43.8 Ų.
Yes, the compound is canonicalized.
The complexity of the compound is 166.