L-Valine,l-arginylglycyl-L-a-aspartyl-

CAS

93674-99-8

Catalog Number

ACM93674998

Category

Other Products

Molecular Weight

445.47

Molecular Formula

C₁₇H₃₁N₇O₇

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

RGDV;ARG-GLY-ASP-VAL;H-ARG-GLY-ASP-VAL-OH;arginyl-glycyl-aspartyl-valine

What is the molecular formula of L-Valine, l-arginylglycyl-L-a-aspartyl?

The molecular formula of L-Valine, l-arginylglycyl-L-a-aspartyl is C17H31N7O7.

What is the molecular weight of L-Valine, l-arginylglycyl-L-a-aspartyl?

The molecular weight of L-Valine, l-arginylglycyl-L-a-aspartyl is 445.5 g/mol.

What is the IUPAC name of L-Valine, l-arginylglycyl-L-a-aspartyl?

The IUPAC name of L-Valine, l-arginylglycyl-L-a-aspartyl is (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-methylbutanoic acid.

What is the InChI of L-Valine, l-arginylglycyl-L-a-aspartyl?

The InChI of L-Valine, l-arginylglycyl-L-a-aspartyl is InChI=1S/C17H31N7O7/c1-8(2)13(16(30)31)24-15(29)10(6-12(26)27)23-11(25)7-22-14(28)9(18)4-3-5-21-17(19)20/h8-10,13H,3-7,18H2,1-2H3,(H,22,28)(H,23,25)(H,24,29)(H,26,27)(H,30,31)(H4,19,20,21)/t9-,10-,13-/m0/s1.

What is the InChIKey of L-Valine, l-arginylglycyl-L-a-aspartyl?

The InChIKey of L-Valine, l-arginylglycyl-L-a-aspartyl is MDNRBNZIOBQHHK-KWBADKCTSA-N.

What is the canonical SMILES of L-Valine, l-arginylglycyl-L-a-aspartyl?

The canonical SMILES of L-Valine, l-arginylglycyl-L-a-aspartyl is CC(C)C(C(=O)O)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(CCCN=C(N)N)N.

What is the CAS number of L-Valine, l-arginylglycyl-L-a-aspartyl?

The CAS number of L-Valine, l-arginylglycyl-L-a-aspartyl is 93674-99-8.

What is the ChEMBL ID of L-Valine, l-arginylglycyl-L-a-aspartyl?

The ChEMBL ID of L-Valine, l-arginylglycyl-L-a-aspartyl is CHEMBL397915.

What is the hydrogen bond donor count of L-Valine, l-arginylglycyl-L-a-aspartyl?

The hydrogen bond donor count of L-Valine, l-arginylglycyl-L-a-aspartyl is 8.

What is the hydrogen bond acceptor count of L-Valine, l-arginylglycyl-L-a-aspartyl?

The hydrogen bond acceptor count of L-Valine, l-arginylglycyl-L-a-aspartyl is 9.