93674-99-8 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C7H5ClN4.
The molecular weight of the compound is 180.59 g/mol.
The IUPAC name of the compound is 3-chloropyrido[2,3-b]pyrazin-6-amine.
The InChI of the compound is InChI=1S/C7H5ClN4/c8-5-3-10-4-1-2-6(9)12-7(4)11-5/h1-3H,(H2,9,11,12).
The InChIKey of the compound is QLIBKHMDPSXBBA-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=NC2=NC(=CN=C21)Cl)N.
The XLogP3-AA value of the compound is 1.1.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor count.
The topological polar surface area of the compound is 64.7 ?2.