936249-94-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H7FN2O.
The molecular weight of the compound is 178.16 g/mol.
The IUPAC name of the compound is 5-(3-fluorophenyl)-1,5-dihydroimidazol-2-one.
The InChI code of the compound is InChI=1S/C9H7FN2O/c10-7-3-1-2-6(4-7)8-5-11-9(13)12-8/h1-5,8H,(H,12,13).
The InChIKey of the compound is CAEQBJPKHATZOY-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC(=C1)F)C2C=NC(=O)N2.
The XLogP3-AA value of the compound is 1.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.