933722-39-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12N2O3.
The molecular weight of the compound is 208.21 g/mol.
The IUPAC name of the compound is methyl 2-oxo-5,6,7,8-tetrahydro-1H-1,6-naphthyridine-3-carboxylate.
The InChI of the compound is InChI=1S/C10H12N2O3/c1-15-10(14)7-4-6-5-11-3-2-8(6)12-9(7)13/h4,11H,2-3,5H2,1H3,(H,12,13).
The InChIKey of the compound is YTVZYKZWTPUAMR-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)C1=CC2=C(CCNC2)NC1=O.
The CAS number of the compound is 933722-83-9.
The XLogP3-AA value of the compound is -0.8.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.