CAS
930-89-2 Purity
---
930-89-2 Purity
---
Inquiry Basket
2-Naphthoic acid
CAS
93-09-4
Catalog Number
ACM93094
Category
Other Products
Molecular Weight
172.18
Molecular Formula
C11H8O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Naphthoic acid according to PubChem?
The molecular formula of 2-Naphthoic acid is C11H8O2.
What is the molecular weight of 2-Naphthoic acid?
The molecular weight of 2-Naphthoic acid is 172.18 g/mol.
What are some synonyms for 2-Naphthoic acid?
Some synonyms for 2-Naphthoic acid include 2-Naphthalenecarboxylic acid and Isonaphthoic acid.
What is the IUPAC name of 2-Naphthoic acid?
The IUPAC name of 2-Naphthoic acid is naphthalene-2-carboxylic acid.
What is the InChIKey of 2-Naphthoic acid?
The InChIKey of 2-Naphthoic acid is UOBYKYZJUGYBDK-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2-Naphthoic acid?
The Canonical SMILES representation of 2-Naphthoic acid is C1=CC=C2C=C(C=CC2=C1)C(=O)O.
What is the CAS number of 2-Naphthoic acid?
The CAS number of 2-Naphthoic acid is 93-09-4.
What is the XLogP3 value of 2-Naphthoic acid?
The XLogP3 value of 2-Naphthoic acid is 3.3.
How many hydrogen bond donor counts does 2-Naphthoic acid have?
2-Naphthoic acid has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Naphthoic acid?
The topological polar surface area of 2-Naphthoic acid is 37.3 Ų.
Recommended Products
CAS
93097-20-2 Purity
96%
93097-20-2 Purity
96%
