What is the molecular formula of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The molecular formula is C10H14N2O3.
What is the molecular weight of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The molecular weight is 210.23 g/mol.
What is the IUPAC name of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The IUPAC name is N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide.
What is the InChI of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The InChI is InChI=1S/C10H14N2O3/c1-14-6-10(13)12-9-4-3-7(15-2)5-8(9)11/h3-5H,6,11H2,1-2H3,(H,12,13).
What is the InChIKey of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The InChIKey is ZWCQORYQXBBTBR-UHFFFAOYSA-N.
What is the Canonical SMILES of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The Canonical SMILES is COCC(=O)NC1=C(C=C(C=C1)OC)N.
How many hydrogen bond donor counts are there in N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
There are 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
There are 4 hydrogen bond acceptor counts.
What is the exact mass of N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide?
The exact mass is 210.10044231 g/mol.
Is N-(2-amino-4-methoxyphenyl)-2-methoxyacetamide canonicalized?
Yes, the compound is canonicalized according to PubChem.