926004-76-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H7FN2.
The synonyms of the compound are 7-fluoro-1H-indol-5-amine, 926028-84-4, 5-AMINO-7-FLUORO-1H-INDOLE, and 1H-INDOL-5-AMINE, 7-FLUORO-.
The molecular weight of the compound is 150.15 g/mol.
The IUPAC name of the compound is 7-fluoro-1H-indol-5-amine.
The InChI of the compound is InChI=1S/C8H7FN2/c9-7-4-6(10)3-5-1-2-11-8(5)7/h1-4,11H,10H2.
The InChIKey of the compound is IBLGHVMLQMHMSQ-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=CNC2=C(C=C(C=C21)N)F.
The CAS number of the compound is 926028-84-4.
The XLogP3-AA value of the compound is 1.5.
Yes, the compound is considered to be canonicalized.