926004-73-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14N4.
The synonyms of the compound are 926028-74-2, 5-(piperazin-1-yl)-1H-pyrrolo[2,3-c]pyridine, 5-piperazin-1-yl-1H-pyrrolo[2,3-c]pyridine, and 1H-Pyrrolo[2,3-c]pyridine.
The molecular weight of the compound is 202.26 g/mol.
The IUPAC name of the compound is 5-piperazin-1-yl-1H-pyrrolo[2,3-c]pyridine.
The InChI of the compound is InChI=1S/C11H14N4/c1-2-13-10-8-14-11(7-9(1)10)15-5-3-12-4-6-15/h1-2,7-8,12-13H,3-6H2.
The InChIKey of the compound is WLRCROSWBUJIMB-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CN(CCN1)C2=NC=C3C(=C2)C=CN3.
The XLogP3-AA value of the compound is 0.8.
The compound has 2 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.