Imipenem-cilastatin sodium hydrate

CAS

92309-29-0

Catalog Number

ACM92309290

Category

Other Products

Molecular Weight

697.80

Molecular Formula

C₁₂H₁₇N₃O₄S.C₁₆H₂₅N₂NaO₅S.H₂O

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

7-[(2S)-2-amino-2-carboxy-ethyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopro panecarbonyl]amino]hept-2-enoic acid: (5R)-3-[2-(aminomethylideneamino )ethylsulfanyl]-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene -2-carboxylic acid;Imipenem-Cilastatin so

Density

g/cm³

What is the molecular formula of imipenem-cilastatin sodium hydrate?

The molecular formula of imipenem-cilastatin sodium hydrate is C28H43N5O9S2.

What are the synonyms for imipenem-cilastatin sodium hydrate?

Some synonyms for imipenem-cilastatin sodium hydrate include Imipenem and cilastatin, Imipenem-Cilastatin sodium hydrate, Thienam, etc.

What is the molecular weight of imipenem-cilastatin sodium hydrate?

The molecular weight of imipenem-cilastatin sodium hydrate is 657.8 g/mol.

What are the component compounds of imipenem-cilastatin sodium hydrate?

The component compounds of imipenem-cilastatin sodium hydrate are Imipenem and Cilastatin.

What is the IUPAC name of imipenem-cilastatin sodium hydrate?

The IUPAC name of imipenem-cilastatin sodium hydrate is (Z)-7-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoic acid;(5R,6S)-3-[2-(aminomethylideneamino)ethylsulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.

What is the InChIKey of imipenem-cilastatin sodium hydrate?

The InChIKey of imipenem-cilastatin sodium hydrate is NCCJWSXETVVUHK-ZYSAIPPVSA-N.

What is the Canonical SMILES of imipenem-cilastatin sodium hydrate?

The Canonical SMILES of imipenem-cilastatin sodium hydrate is CC(C1C2CC(=C(N2C1=O)C(=O)O)SCCN=CN)O.CC1(CC1C(=O)NC(=CCCCCSCC(C(=O)O)N)C(=O)O)C.

What are the other identifiers of imipenem-cilastatin sodium hydrate?

Some other identifiers of imipenem-cilastatin sodium hydrate include CAS: 92309-29-0, Related CAS: 85960-17-4 (hydrochloride salt), and ChEMBL ID: CHEMBL1628401.

What is the hydrogen bond donor count of imipenem-cilastatin sodium hydrate?

The hydrogen bond donor count of imipenem-cilastatin sodium hydrate is 7.

How does cilastatin enhance the efficacy of imipenem as an anti-bacterial agent?

Cilastatin inhibits renal dehydropeptidase I to prolong the half-life and increase the tissue penetration of imipenem, enhancing its efficacy as an anti-bacterial agent.