What is the molecular formula of [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
The molecular formula is C8H12Cl2N2O.
What are some synonyms for [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
Some synonyms include 69782-24-7, [2-(4-chlorophenoxy)ethyl]hydrazine hydrochloride, and 2-(4-chlorophenoxy)ethylhydrazine hydrochloride.
What is the molecular weight of [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
The molecular weight is 223.10 g/mol.
What is the IUPAC name of [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
The IUPAC name is 2-(4-chlorophenoxy)ethylhydrazine;hydrochloride.
What is the InChI of [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
The InChI is InChI=1S/C8H11ClN2O.ClH/c9-7-1-3-8(4-2-7)12-6-5-11-10;/h1-4,11H,5-6,10H2;1H.
How many hydrogen bond donor counts does [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride have?
It has 3 hydrogen bond donor counts.
What is the exact mass of [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
The exact mass is 222.0326684 g/mol.
How many rotatable bond counts does [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride have?
It has 4 rotatable bond counts.
Is [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.
What is the topological polar surface area of [2-(4-Chlorophenoxy)ethyl]hydrazine hydrochloride?
The topological polar surface area is 47.3 Å2.