CAS
92207-22-2 Purity
96%
92207-22-2 Purity
96%
![(S)-2-[(t-Butoxycarbonyl)amino]-octanoic acid;L-α-[(Butoxycarbonyl)amino]-caprylic acid](https://resource.alfa-chemistry.com/structure/92211-95-5.gif)
Shopping basket
3-Nitro-2H-chromene
CAS
92210-53-2
Catalog Number
ACM92210532
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Nitro-2H-chromene?
The molecular formula of 3-Nitro-2H-chromene is C9H7NO3.
When was 3-Nitro-2H-chromene created?
3-Nitro-2H-chromene was created on February 8, 2007.
What is the IUPAC name of 3-Nitro-2H-chromene?
The IUPAC name of 3-Nitro-2H-chromene is 3-nitro-2H-chromene.
What is the canonical SMILES of 3-Nitro-2H-chromene?
The canonical SMILES of 3-Nitro-2H-chromene is C1C(=CC2=CC=CC=C2O1)[N+](=O)[O-].
What is the molecular weight of 3-Nitro-2H-chromene?
The molecular weight of 3-Nitro-2H-chromene is 177.16 g/mol.
How many hydrogen bond donor count does 3-Nitro-2H-chromene have?
3-Nitro-2H-chromene has 0 hydrogen bond donor count.
What is the exact mass of 3-Nitro-2H-chromene?
The exact mass of 3-Nitro-2H-chromene is 177.042593085 g/mol.
What is the topological polar surface area of 3-Nitro-2H-chromene?
The topological polar surface area of 3-Nitro-2H-chromene is 55 2.
How many heavy atom counts does 3-Nitro-2H-chromene have?
3-Nitro-2H-chromene has 13 heavy atom counts.
Is the compound 3-Nitro-2H-chromene canonicalized?
Yes, the compound 3-Nitro-2H-chromene is canonicalized.
Recommended Products
