What is the molecular formula of the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The molecular formula is C15H23ClN2O.
What is the molecular weight of Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The molecular weight is 282.81 g/mol.
What are the synonyms of the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The synonyms are listed as Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride, 92207-22-2, UNII-3LD136RM6U, and EINECS 296-085-9.
What is the IUPAC name of the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The IUPAC name is benzyl-dimethyl-(2-oxoazepan-3-yl)azanium;chloride.
What is the Canonical SMILES representation of Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The Canonical SMILES representation is C[N+](C)(CC1=CC=CC=C1)C2CCCCNC2=O.[Cl-].
What is the CAS number of the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The CAS number is 92207-22-2.
How many hydrogen bond donor counts are there in the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
There is one hydrogen bond donor count.
How many rotatable bond counts are there in the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
There are three rotatable bond counts.
What is the exact mass of Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride?
The exact mass is 282.1498911 g/mol.
Is the compound Benzyl(hexahydro-2-oxo-1H-azepin-3-yl)dimethylammonium chloride canonicalized?
Yes, the compound is canonicalized.