What is the molecular formula of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The molecular formula is C8H10N4O.
What are the synonyms of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The synonyms are 92146-08-2, 4,6-Dimethyl-3,7-dihydropteridin-2(1H)-one, and DTXSID80633810.
What is the molecular weight of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The molecular weight is 178.19 g/mol.
When was 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci) created and modified on PubChem?
It was created on 2019-01-17 and modified on 2023-12-30.
What is the IUPAC name of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The IUPAC name is 4,6-dimethyl-7,8-dihydro-3H-pteridin-2-one.
What is the InChI of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The InChI is InChI=1S/C8H10N4O/c1-4-3-9-7-6(10-4)5(2)11-8(13)12-7/h3H2,1-2H3,(H2,9,11,12,13).
What is the InChIKey of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The InChIKey is VXDVIQNGOCUBMS-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The Canonical SMILES is CC1=NC2=C(NC(=O)N=C2NC1)C.
What is the XLogP3-AA value of 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci)?
The XLogP3-AA value is -0.8.
How many hydrogen bond donor counts does 2-Pteridinol,7,8-dihydro-4,6-dimethyl-(7ci) have?
It has 2 hydrogen bond donor counts.