92142-32-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound with PubChem CID 56345 is (3R,4R)-7-methyl-3,4-dihydrobenzo[c]acridine-3,4-diol.
The molecular weight of the compound is 277.3 g/mol.
The InChIKey of the compound is FDRGZRMEGHZBID-SJLPKXTDSA-N.
The canonical SMILES representation of the compound is CC1=C2C=CC3=C(C2=NC4=CC=CC=C14)C=CC(C3O)O.
The compound has 2 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 53.4 ?2.
The compound has 21 heavy atoms.
Yes, the compound has 2 defined atom stereocenter counts.
Yes, the compound is canonicalized.